C8H8N2O3S2 — CID 21424583
2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid (PubChem CID 21424583) has the molecular formula C8H8N2O3S2 and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid.
| Compound Name | 2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid |
|---|---|
| PubChem CID | 21424583 |
| Molecular Formula | C8H8N2O3S2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.00 |
| IUPAC Name | 2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid |
| SMILES | Cc1ccc2sc(N)nc2c1S(=O)(=O)O |
| InChI | InChI=1S/C8H8N2O3S2/c1-4-2-3-5-6(10-8(9)14-5)7(4)15(11,12)13/h2-3H,1H3,(H2,9,10)(H,11,12,13) |
| InChIKey | PGOTWXIBPRHVIP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|