2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid

C8H8N2O3S2 — CID 21424583

IUPAC2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid
SMILESCc1ccc2sc(N)nc2c1S(=O)(=O)O
InChIInChI=1S/C8H8N2O3S2/c1-4-2-3-5-6(10-8(9)14-5)7(4)15(11,12)13/h2-3H,1H3,(H2,9,10)(H,11,12,13)
InChIKeyPGOTWXIBPRHVIP-UHFFFAOYSA-N
MW244.30 g/mol
LogP1.43
Rot. Bonds1

About 2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid

2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid (PubChem CID 21424583) has the molecular formula C8H8N2O3S2 and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid.

Molecular Properties

Compound Name2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid
PubChem CID21424583
Molecular FormulaC8H8N2O3S2
Molecular Weight244.30 g/mol
Exact Mass244.00
IUPAC Name2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid
SMILESCc1ccc2sc(N)nc2c1S(=O)(=O)O
InChIInChI=1S/C8H8N2O3S2/c1-4-2-3-5-6(10-8(9)14-5)7(4)15(11,12)13/h2-3H,1H3,(H2,9,10)(H,11,12,13)
InChIKeyPGOTWXIBPRHVIP-UHFFFAOYSA-N
XLogP1.43
TPSA93.28 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.30
LogP ≤ 51.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid?
The IUPAC name of 2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid (CID 21424583) is 2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid.
What is the SMILES notation for 2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid?
The canonical SMILES for 2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid is Cc1ccc2sc(N)nc2c1S(=O)(=O)O.
What is the InChIKey of 2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid?
The InChIKey is PGOTWXIBPRHVIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3S2/c1-4-2-3-5-6(10-8(9)14-5)7(4)15(11,12)13/h2-3H,1H3,(H2,9,10)(H,11,12,13).
What are the key properties of 2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid?
2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid has a molecular weight of 244.30 g/mol, XLogP of 1.43, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-methyl-1,3-benzothiazole-4-sulfonic acid is sourced from PubChem (CID 21424583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).