C11H5F2N3OS — CID 54772816
2-amino-7,10-difluoro-[1,3]thiazino[5,6-c]quinolin-4-one (PubChem CID 54772816) has the molecular formula C11H5F2N3OS and a molecular weight of 265.24 g/mol. Its IUPAC name is 2-amino-7,10-difluoro-[1,3]thiazino[5,6-c]quinolin-4-one.
| Compound Name | 2-amino-7,10-difluoro-[1,3]thiazino[5,6-c]quinolin-4-one |
|---|---|
| PubChem CID | 54772816 |
| Molecular Formula | C11H5F2N3OS |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 2-amino-7,10-difluoro-[1,3]thiazino[5,6-c]quinolin-4-one |
| SMILES | Nc1nc(=O)c2cnc3c(F)ccc(F)c3c2s1 |
| InChI | InChI=1S/C11H5F2N3OS/c12-5-1-2-6(13)8-7(5)9-4(3-15-8)10(17)16-11(14)18-9/h1-3H,(H2,14,16,17) |
| InChIKey | DXTVZMVIVZIYEW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|