C8H5Cl2F2NO2 — CID 130099415
methyl 5,6-dichloro-2-(difluoromethyl)pyridine-3-carboxylate (PubChem CID 130099415) has the molecular formula C8H5Cl2F2NO2 and a molecular weight of 256.03 g/mol. Its IUPAC name is methyl 5,6-dichloro-2-(difluoromethyl)pyridine-3-carboxylate.
| Compound Name | methyl 5,6-dichloro-2-(difluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 130099415 |
| Molecular Formula | C8H5Cl2F2NO2 |
| Molecular Weight | 256.03 g/mol |
| Exact Mass | 254.97 |
| IUPAC Name | methyl 5,6-dichloro-2-(difluoromethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(Cl)c(Cl)nc1C(F)F |
| InChI | InChI=1S/C8H5Cl2F2NO2/c1-15-8(14)3-2-4(9)6(10)13-5(3)7(11)12/h2,7H,1H3 |
| InChIKey | ARBLKBQEPUBJGZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.03 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|