C9H8BrF2NO3 — CID 130084949
methyl 6-(bromomethyl)-2-(difluoromethyl)-5-hydroxypyridine-3-carboxylate (PubChem CID 130084949) has the molecular formula C9H8BrF2NO3 and a molecular weight of 296.07 g/mol. Its IUPAC name is methyl 6-(bromomethyl)-2-(difluoromethyl)-5-hydroxypyridine-3-carboxylate.
| Compound Name | methyl 6-(bromomethyl)-2-(difluoromethyl)-5-hydroxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 130084949 |
| Molecular Formula | C9H8BrF2NO3 |
| Molecular Weight | 296.07 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | methyl 6-(bromomethyl)-2-(difluoromethyl)-5-hydroxypyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(O)c(CBr)nc1C(F)F |
| InChI | InChI=1S/C9H8BrF2NO3/c1-16-9(15)4-2-6(14)5(3-10)13-7(4)8(11)12/h2,8,14H,3H2,1H3 |
| InChIKey | FCUUGGDUVDNLSC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.07 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|