C8H11N3O2 — CID 18175252
methyl 5-amino-2,6-dimethylpyrimidine-4-carboxylate (PubChem CID 18175252) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is methyl 5-amino-2,6-dimethylpyrimidine-4-carboxylate.
| Compound Name | methyl 5-amino-2,6-dimethylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 18175252 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | methyl 5-amino-2,6-dimethylpyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(C)nc(C)c1N |
| InChI | InChI=1S/C8H11N3O2/c1-4-6(9)7(8(12)13-3)11-5(2)10-4/h9H2,1-3H3 |
| InChIKey | FNXSFPICRGARMF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |