C14H8ClF2N3O2 — CID 172844896
methyl 4-amino-6-chloro-3-(4-cyano-2-fluorophenyl)-5-fluoropyridine-2-carboxylate (PubChem CID 172844896) has the molecular formula C14H8ClF2N3O2 and a molecular weight of 323.69 g/mol. Its IUPAC name is methyl 4-amino-6-chloro-3-(4-cyano-2-fluorophenyl)-5-fluoropyridine-2-carboxylate.
| Compound Name | methyl 4-amino-6-chloro-3-(4-cyano-2-fluorophenyl)-5-fluoropyridine-2-carboxylate |
|---|---|
| PubChem CID | 172844896 |
| Molecular Formula | C14H8ClF2N3O2 |
| Molecular Weight | 323.69 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | methyl 4-amino-6-chloro-3-(4-cyano-2-fluorophenyl)-5-fluoropyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(Cl)c(F)c(N)c1-c1ccc(C#N)cc1F |
| InChI | InChI=1S/C14H8ClF2N3O2/c1-22-14(21)12-9(11(19)10(17)13(15)20-12)7-3-2-6(5-18)4-8(7)16/h2-4H,1H3,(H2,19,20) |
| InChIKey | XHBGWJIQMUREPN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.69 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|