C15H12F4N2O3 — CID 71175262
methyl 4-amino-5-fluoro-3-methoxy-6-[4-(trifluoromethyl)phenyl]pyridine-2-carboxylate (PubChem CID 71175262) has the molecular formula C15H12F4N2O3 and a molecular weight of 344.26 g/mol. Its IUPAC name is methyl 4-amino-5-fluoro-3-methoxy-6-[4-(trifluoromethyl)phenyl]pyridine-2-carboxylate.
| Compound Name | methyl 4-amino-5-fluoro-3-methoxy-6-[4-(trifluoromethyl)phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 71175262 |
| Molecular Formula | C15H12F4N2O3 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | methyl 4-amino-5-fluoro-3-methoxy-6-[4-(trifluoromethyl)phenyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(C(F)(F)F)cc2)c(F)c(N)c1OC |
| InChI | InChI=1S/C15H12F4N2O3/c1-23-13-10(20)9(16)11(21-12(13)14(22)24-2)7-3-5-8(6-4-7)15(17,18)19/h3-6H,1-2H3,(H2,20,21) |
| InChIKey | VZJWPLLYPKEMPJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |