C16H14F3N3O2 — CID 66779158
methyl 6-amino-5-prop-2-enyl-2-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxylate (PubChem CID 66779158) has the molecular formula C16H14F3N3O2 and a molecular weight of 337.30 g/mol. Its IUPAC name is methyl 6-amino-5-prop-2-enyl-2-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxylate.
| Compound Name | methyl 6-amino-5-prop-2-enyl-2-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 66779158 |
| Molecular Formula | C16H14F3N3O2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | methyl 6-amino-5-prop-2-enyl-2-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxylate |
| SMILES | C=CCc1c(N)nc(-c2ccc(C(F)(F)F)cc2)nc1C(=O)OC |
| InChI | InChI=1S/C16H14F3N3O2/c1-3-4-11-12(15(23)24-2)21-14(22-13(11)20)9-5-7-10(8-6-9)16(17,18)19/h3,5-8H,1,4H2,2H3,(H2,20,21,22) |
| InChIKey | HVHQFNLFONKEBS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|