About methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate
methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate (PubChem CID 123520014) has the molecular formula C13H8F5N3O3
and a molecular weight of 349.22 g/mol. Its IUPAC name is methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate |
| PubChem CID | 123520014 |
| Molecular Formula | C13H8F5N3O3 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(C(F)(F)F)c(F)c2F)nc(N)c1O |
| InChI | InChI=1S/C13H8F5N3O3/c1-24-12(23)8-9(22)10(19)21-11(20-8)4-2-3-5(13(16,17)18)7(15)6(4)14/h2-3,22H,1H3,(H2,19,20,21) |
| InChIKey | MOBMOGRHZMZPEX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate?
The IUPAC name of methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate (CID 123520014) is methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate.
What is the SMILES notation for methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate?
The canonical SMILES for methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate is COC(=O)c1nc(-c2ccc(C(F)(F)F)c(F)c2F)nc(N)c1O.
What is the InChIKey of methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate?
The InChIKey is MOBMOGRHZMZPEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F5N3O3/c1-24-12(23)8-9(22)10(19)21-11(20-8)4-2-3-5(13(16,17)18)7(15)6(4)14/h2-3,22H,1H3,(H2,19,20,21).
What are the key properties of methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate?
methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate has a molecular weight of 349.22 g/mol, XLogP of 2.52, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-amino-2-[2,3-difluoro-4-(trifluoromethyl)phenyl]-5-hydroxypyrimidine-4-carboxylate is sourced from PubChem (CID 123520014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).