C17H18ClF2N3O2Si — CID 70497077
methyl 6-amino-2-(4-chloro-2,3-difluorophenyl)-5-(2-trimethylsilylethenyl)pyrimidine-4-carboxylate (PubChem CID 70497077) has the molecular formula C17H18ClF2N3O2Si and a molecular weight of 397.89 g/mol. Its IUPAC name is methyl 6-amino-2-(4-chloro-2,3-difluorophenyl)-5-(2-trimethylsilylethenyl)pyrimidine-4-carboxylate.
| Compound Name | methyl 6-amino-2-(4-chloro-2,3-difluorophenyl)-5-(2-trimethylsilylethenyl)pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 70497077 |
| Molecular Formula | C17H18ClF2N3O2Si |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | methyl 6-amino-2-(4-chloro-2,3-difluorophenyl)-5-(2-trimethylsilylethenyl)pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(Cl)c(F)c2F)nc(N)c1C=C[Si](C)(C)C |
| InChI | InChI=1S/C17H18ClF2N3O2Si/c1-25-17(24)14-10(7-8-26(2,3)4)15(21)23-16(22-14)9-5-6-11(18)13(20)12(9)19/h5-8H,1-4H3,(H2,21,22,23) |
| InChIKey | MZRANJFBBBWSBG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|