C17H14ClFN2O3S — CID 123588478
methyl 2-(4-chloro-2-fluoro-3-methoxyphenyl)-6-methanethioyl-5-prop-1-enylpyrimidine-4-carboxylate (PubChem CID 123588478) has the molecular formula C17H14ClFN2O3S and a molecular weight of 380.83 g/mol. Its IUPAC name is methyl 2-(4-chloro-2-fluoro-3-methoxyphenyl)-6-methanethioyl-5-prop-1-enylpyrimidine-4-carboxylate.
| Compound Name | methyl 2-(4-chloro-2-fluoro-3-methoxyphenyl)-6-methanethioyl-5-prop-1-enylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 123588478 |
| Molecular Formula | C17H14ClFN2O3S |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | methyl 2-(4-chloro-2-fluoro-3-methoxyphenyl)-6-methanethioyl-5-prop-1-enylpyrimidine-4-carboxylate |
| SMILES | CC=Cc1c(C=S)nc(-c2ccc(Cl)c(OC)c2F)nc1C(=O)OC |
| InChI | InChI=1S/C17H14ClFN2O3S/c1-4-5-9-12(8-25)20-16(21-14(9)17(22)24-3)10-6-7-11(18)15(23-2)13(10)19/h4-8H,1-3H3 |
| InChIKey | YSOUBYHNEKWHJK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|