C22H18ClFN4O5 — CID 67496186
methyl 2-(4-chloro-2-fluoro-3-methoxyphenyl)-5-ethenyl-6-[(2-nitrophenyl)methylamino]pyrimidine-4-carboxylate (PubChem CID 67496186) has the molecular formula C22H18ClFN4O5 and a molecular weight of 472.86 g/mol. Its IUPAC name is methyl 2-(4-chloro-2-fluoro-3-methoxyphenyl)-5-ethenyl-6-[(2-nitrophenyl)methylamino]pyrimidine-4-carboxylate.
| Compound Name | methyl 2-(4-chloro-2-fluoro-3-methoxyphenyl)-5-ethenyl-6-[(2-nitrophenyl)methylamino]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 67496186 |
| Molecular Formula | C22H18ClFN4O5 |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | methyl 2-(4-chloro-2-fluoro-3-methoxyphenyl)-5-ethenyl-6-[(2-nitrophenyl)methylamino]pyrimidine-4-carboxylate |
| SMILES | C=Cc1c(NCc2ccccc2[N+](=O)[O-])nc(-c2ccc(Cl)c(OC)c2F)nc1C(=O)OC |
| InChI | InChI=1S/C22H18ClFN4O5/c1-4-13-18(22(29)33-3)26-21(14-9-10-15(23)19(32-2)17(14)24)27-20(13)25-11-12-7-5-6-8-16(12)28(30)31/h4-10H,1,11H2,2-3H3,(H,25,26,27) |
| InChIKey | QFYKRZXZYWNINC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|