C15H11Cl2NO5 — CID 9125714
(2-nitrophenyl)methyl 3,5-dichloro-4-methoxybenzoate (PubChem CID 9125714) has the molecular formula C15H11Cl2NO5 and a molecular weight of 356.16 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 3,5-dichloro-4-methoxybenzoate.
| Compound Name | (2-nitrophenyl)methyl 3,5-dichloro-4-methoxybenzoate |
|---|---|
| PubChem CID | 9125714 |
| Molecular Formula | C15H11Cl2NO5 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | (2-nitrophenyl)methyl 3,5-dichloro-4-methoxybenzoate |
| SMILES | COc1c(Cl)cc(C(=O)OCc2ccccc2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H11Cl2NO5/c1-22-14-11(16)6-10(7-12(14)17)15(19)23-8-9-4-2-3-5-13(9)18(20)21/h2-7H,8H2,1H3 |
| InChIKey | AGWILENYOZCZOW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|