C13H7Cl3N2O4 — CID 7649074
(2-nitrophenyl)methyl 3,4,5-trichloropyridine-2-carboxylate (PubChem CID 7649074) has the molecular formula C13H7Cl3N2O4 and a molecular weight of 361.57 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 3,4,5-trichloropyridine-2-carboxylate.
| Compound Name | (2-nitrophenyl)methyl 3,4,5-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 7649074 |
| Molecular Formula | C13H7Cl3N2O4 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | (2-nitrophenyl)methyl 3,4,5-trichloropyridine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1[N+](=O)[O-])c1ncc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H7Cl3N2O4/c14-8-5-17-12(11(16)10(8)15)13(19)22-6-7-3-1-2-4-9(7)18(20)21/h1-5H,6H2 |
| InChIKey | FEPKTTWAEUWMHJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|