C10H7Cl2N5O2 — CID 114156678
3,6-dichloro-N-[(2-nitrophenyl)methyl]-1,2,4-triazin-5-amine (PubChem CID 114156678) has the molecular formula C10H7Cl2N5O2 and a molecular weight of 300.11 g/mol. Its IUPAC name is 3,6-dichloro-N-[(2-nitrophenyl)methyl]-1,2,4-triazin-5-amine.
| Compound Name | 3,6-dichloro-N-[(2-nitrophenyl)methyl]-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 114156678 |
| Molecular Formula | C10H7Cl2N5O2 |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 3,6-dichloro-N-[(2-nitrophenyl)methyl]-1,2,4-triazin-5-amine |
| SMILES | O=[N+]([O-])c1ccccc1CNc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C10H7Cl2N5O2/c11-8-9(14-10(12)16-15-8)13-5-6-3-1-2-4-7(6)17(18)19/h1-4H,5H2,(H,13,14,16) |
| InChIKey | STCWZMTUMGRYQC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|