C13H8BrCl2N3O4 — CID 89404961
3-bromo-5,6-dichloro-4-[(2-nitrophenyl)methylamino]pyridine-2-carboxylic acid (PubChem CID 89404961) has the molecular formula C13H8BrCl2N3O4 and a molecular weight of 421.03 g/mol. Its IUPAC name is 3-bromo-5,6-dichloro-4-[(2-nitrophenyl)methylamino]pyridine-2-carboxylic acid.
| Compound Name | 3-bromo-5,6-dichloro-4-[(2-nitrophenyl)methylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 89404961 |
| Molecular Formula | C13H8BrCl2N3O4 |
| Molecular Weight | 421.03 g/mol |
| Exact Mass | 418.91 |
| IUPAC Name | 3-bromo-5,6-dichloro-4-[(2-nitrophenyl)methylamino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc(Cl)c(Cl)c(NCc2ccccc2[N+](=O)[O-])c1Br |
| InChI | InChI=1S/C13H8BrCl2N3O4/c14-8-10(9(15)12(16)18-11(8)13(20)21)17-5-6-3-1-2-4-7(6)19(22)23/h1-4H,5H2,(H,17,18)(H,20,21) |
| InChIKey | SBFVXAKQZBJIQK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.03 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|