C16H13ClFN5O3 — CID 86668738
methyl 6-azido-2-(4-chloro-2-fluoro-3-methoxyphenyl)-5-[(Z)-prop-1-enyl]pyrimidine-4-carboxylate (PubChem CID 86668738) has the molecular formula C16H13ClFN5O3 and a molecular weight of 377.76 g/mol. Its IUPAC name is methyl 6-azido-2-(4-chloro-2-fluoro-3-methoxyphenyl)-5-[(Z)-prop-1-enyl]pyrimidine-4-carboxylate.
| Compound Name | methyl 6-azido-2-(4-chloro-2-fluoro-3-methoxyphenyl)-5-[(Z)-prop-1-enyl]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 86668738 |
| Molecular Formula | C16H13ClFN5O3 |
| Molecular Weight | 377.76 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | methyl 6-azido-2-(4-chloro-2-fluoro-3-methoxyphenyl)-5-[(Z)-prop-1-enyl]pyrimidine-4-carboxylate |
| SMILES | C/C=C\c1c(N=[N+]=[N-])nc(-c2ccc(Cl)c(OC)c2F)nc1C(=O)OC |
| InChI | InChI=1S/C16H13ClFN5O3/c1-4-5-9-12(16(24)26-3)20-14(21-15(9)22-23-19)8-6-7-10(17)13(25-2)11(8)18/h4-7H,1-3H3/b5-4- |
| InChIKey | YORVESXWBNHABT-PLNGDYQASA-N |
| XLogP | 4.71 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.76 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|