C16H14Cl2FN3O3 — CID 67110467
methyl 5-chloro-2-(4-chloro-2-fluoro-3-methoxyphenyl)-6-(prop-2-enylamino)pyrimidine-4-carboxylate (PubChem CID 67110467) has the molecular formula C16H14Cl2FN3O3 and a molecular weight of 386.21 g/mol. Its IUPAC name is methyl 5-chloro-2-(4-chloro-2-fluoro-3-methoxyphenyl)-6-(prop-2-enylamino)pyrimidine-4-carboxylate.
| Compound Name | methyl 5-chloro-2-(4-chloro-2-fluoro-3-methoxyphenyl)-6-(prop-2-enylamino)pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 67110467 |
| Molecular Formula | C16H14Cl2FN3O3 |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | methyl 5-chloro-2-(4-chloro-2-fluoro-3-methoxyphenyl)-6-(prop-2-enylamino)pyrimidine-4-carboxylate |
| SMILES | C=CCNc1nc(-c2ccc(Cl)c(OC)c2F)nc(C(=O)OC)c1Cl |
| InChI | InChI=1S/C16H14Cl2FN3O3/c1-4-7-20-15-10(18)12(16(23)25-3)21-14(22-15)8-5-6-9(17)13(24-2)11(8)19/h4-6H,1,7H2,2-3H3,(H,20,21,22) |
| InChIKey | POCKCAAKRJERFF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|