C18H19ClF2N2O2Si — CID 70497567
methyl 4-amino-6-(4-chloro-3-fluorophenyl)-5-fluoro-3-(2-trimethylsilylethenyl)pyridine-2-carboxylate (PubChem CID 70497567) has the molecular formula C18H19ClF2N2O2Si and a molecular weight of 396.90 g/mol. Its IUPAC name is methyl 4-amino-6-(4-chloro-3-fluorophenyl)-5-fluoro-3-(2-trimethylsilylethenyl)pyridine-2-carboxylate.
| Compound Name | methyl 4-amino-6-(4-chloro-3-fluorophenyl)-5-fluoro-3-(2-trimethylsilylethenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 70497567 |
| Molecular Formula | C18H19ClF2N2O2Si |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | methyl 4-amino-6-(4-chloro-3-fluorophenyl)-5-fluoro-3-(2-trimethylsilylethenyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(Cl)c(F)c2)c(F)c(N)c1C=C[Si](C)(C)C |
| InChI | InChI=1S/C18H19ClF2N2O2Si/c1-25-18(24)17-11(7-8-26(2,3)4)15(22)14(21)16(23-17)10-5-6-12(19)13(20)9-10/h5-9H,1-4H3,(H2,22,23) |
| InChIKey | BJGQIESXOKHRFZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|