C14H12FN3O4 — CID 90409124
methyl 6-amino-2-(2-fluoro-4-formylphenyl)-5-methoxypyrimidine-4-carboxylate (PubChem CID 90409124) has the molecular formula C14H12FN3O4 and a molecular weight of 305.27 g/mol. Its IUPAC name is methyl 6-amino-2-(2-fluoro-4-formylphenyl)-5-methoxypyrimidine-4-carboxylate.
| Compound Name | methyl 6-amino-2-(2-fluoro-4-formylphenyl)-5-methoxypyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 90409124 |
| Molecular Formula | C14H12FN3O4 |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | methyl 6-amino-2-(2-fluoro-4-formylphenyl)-5-methoxypyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(C=O)cc2F)nc(N)c1OC |
| InChI | InChI=1S/C14H12FN3O4/c1-21-11-10(14(20)22-2)17-13(18-12(11)16)8-4-3-7(6-19)5-9(8)15/h3-6H,1-2H3,(H2,16,17,18) |
| InChIKey | HZTUJBORYGIYIQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|