C14H9F2N3O3 — CID 90440351
6-amino-2-(4-ethynyl-2,3-difluorophenyl)-5-methoxypyrimidine-4-carboxylic acid (PubChem CID 90440351) has the molecular formula C14H9F2N3O3 and a molecular weight of 305.24 g/mol. Its IUPAC name is 6-amino-2-(4-ethynyl-2,3-difluorophenyl)-5-methoxypyrimidine-4-carboxylic acid.
| Compound Name | 6-amino-2-(4-ethynyl-2,3-difluorophenyl)-5-methoxypyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 90440351 |
| Molecular Formula | C14H9F2N3O3 |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 6-amino-2-(4-ethynyl-2,3-difluorophenyl)-5-methoxypyrimidine-4-carboxylic acid |
| SMILES | C#Cc1ccc(-c2nc(N)c(OC)c(C(=O)O)n2)c(F)c1F |
| InChI | InChI=1S/C14H9F2N3O3/c1-3-6-4-5-7(9(16)8(6)15)13-18-10(14(20)21)11(22-2)12(17)19-13/h1,4-5H,2H3,(H,20,21)(H2,17,18,19) |
| InChIKey | PUQRJRRBZSELKA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|