C15H12ClN3O4 — CID 90451038
methyl 6-amino-2-(7-chloro-1-benzofuran-4-yl)-5-methoxypyrimidine-4-carboxylate (PubChem CID 90451038) has the molecular formula C15H12ClN3O4 and a molecular weight of 333.73 g/mol. Its IUPAC name is methyl 6-amino-2-(7-chloro-1-benzofuran-4-yl)-5-methoxypyrimidine-4-carboxylate.
| Compound Name | methyl 6-amino-2-(7-chloro-1-benzofuran-4-yl)-5-methoxypyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 90451038 |
| Molecular Formula | C15H12ClN3O4 |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | methyl 6-amino-2-(7-chloro-1-benzofuran-4-yl)-5-methoxypyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(Cl)c3occc23)nc(N)c1OC |
| InChI | InChI=1S/C15H12ClN3O4/c1-21-12-10(15(20)22-2)18-14(19-13(12)17)8-3-4-9(16)11-7(8)5-6-23-11/h3-6H,1-2H3,(H2,17,18,19) |
| InChIKey | FECLPZSPHMJLAE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |