C11H9F2N3 — CID 112675515
3-N-(3,5-difluoro-2-pyridinyl)benzene-1,3-diamine (PubChem CID 112675515) has the molecular formula C11H9F2N3 and a molecular weight of 221.21 g/mol. Its IUPAC name is 3-N-(3,5-difluoro-2-pyridinyl)benzene-1,3-diamine.
| Compound Name | 3-N-(3,5-difluoro-2-pyridinyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 112675515 |
| Molecular Formula | C11H9F2N3 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 3-N-(3,5-difluoro-2-pyridinyl)benzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2ncc(F)cc2F)c1 |
| InChI | InChI=1S/C11H9F2N3/c12-7-4-10(13)11(15-6-7)16-9-3-1-2-8(14)5-9/h1-6H,14H2,(H,15,16) |
| InChIKey | HQNRGVMYIRZKFC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|