C16H14FN5O — CID 143794301
5-[[6-(3-aminoanilino)pyrimidin-4-yl]amino]-2-fluorophenol (PubChem CID 143794301) has the molecular formula C16H14FN5O and a molecular weight of 311.32 g/mol. Its IUPAC name is 5-[[6-(3-aminoanilino)pyrimidin-4-yl]amino]-2-fluorophenol.
| Compound Name | 5-[[6-(3-aminoanilino)pyrimidin-4-yl]amino]-2-fluorophenol |
|---|---|
| PubChem CID | 143794301 |
| Molecular Formula | C16H14FN5O |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 5-[[6-(3-aminoanilino)pyrimidin-4-yl]amino]-2-fluorophenol |
| SMILES | Nc1cccc(Nc2cc(Nc3ccc(F)c(O)c3)ncn2)c1 |
| InChI | InChI=1S/C16H14FN5O/c17-13-5-4-12(7-14(13)23)22-16-8-15(19-9-20-16)21-11-3-1-2-10(18)6-11/h1-9,23H,18H2,(H2,19,20,21,22) |
| InChIKey | HLNYVOZTZJSDKG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|