C25H26FN5O — CID 143794224
5-[[6-(3-aminoanilino)pyrimidin-4-yl]amino]-2-methylphenol;1-ethyl-3-fluorobenzene (PubChem CID 143794224) has the molecular formula C25H26FN5O and a molecular weight of 431.52 g/mol. Its IUPAC name is 5-[[6-(3-aminoanilino)pyrimidin-4-yl]amino]-2-methylphenol;1-ethyl-3-fluorobenzene.
| Compound Name | 5-[[6-(3-aminoanilino)pyrimidin-4-yl]amino]-2-methylphenol;1-ethyl-3-fluorobenzene |
|---|---|
| PubChem CID | 143794224 |
| Molecular Formula | C25H26FN5O |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 5-[[6-(3-aminoanilino)pyrimidin-4-yl]amino]-2-methylphenol;1-ethyl-3-fluorobenzene |
| SMILES | CCc1cccc(F)c1.Cc1ccc(Nc2cc(Nc3cccc(N)c3)ncn2)cc1O |
| InChI | InChI=1S/C17H17N5O.C8H9F/c1-11-5-6-14(8-15(11)23)22-17-9-16(19-10-20-17)21-13-4-2-3-12(18)7-13;1-2-7-4-3-5-8(9)6-7/h2-10,23H,18H2,1H3,(H2,19,20,21,22);3-6H,2H2,1H3 |
| InChIKey | QBMIROAUHSAIBW-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|