C26H22FN5O — CID 69087263
6-(3-aminophenyl)-N-[4-[(3-fluorophenyl)methoxy]-3-methylphenyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 69087263) has the molecular formula C26H22FN5O and a molecular weight of 439.49 g/mol. Its IUPAC name is 6-(3-aminophenyl)-N-[4-[(3-fluorophenyl)methoxy]-3-methylphenyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-(3-aminophenyl)-N-[4-[(3-fluorophenyl)methoxy]-3-methylphenyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 69087263 |
| Molecular Formula | C26H22FN5O |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 6-(3-aminophenyl)-N-[4-[(3-fluorophenyl)methoxy]-3-methylphenyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ncnc3cc(-c4cccc(N)c4)[nH]c23)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C26H22FN5O/c1-16-10-21(8-9-24(16)33-14-17-4-2-6-19(27)11-17)31-26-25-23(29-15-30-26)13-22(32-25)18-5-3-7-20(28)12-18/h2-13,15,32H,14,28H2,1H3,(H,29,30,31) |
| InChIKey | LOPMQISDEFWLER-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|