C25H20AsN5O — CID 87519086
CID 87519086 (PubChem CID 87519086) has the molecular formula C25H20AsN5O and a molecular weight of 481.39 g/mol.
| Compound Name | CID 87519086 |
|---|---|
| PubChem CID | 87519086 |
| Molecular Formula | C25H20AsN5O |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | — |
| SMILES | Cc1ccc(Oc2ccc(Nc3ncnc4cc(-c5cccc([As])c5)[nH]c34)cc2C)cn1 |
| InChI | InChI=1S/C25H20AsN5O/c1-15-10-19(7-9-23(15)32-20-8-6-16(2)27-13-20)30-25-24-22(28-14-29-25)12-21(31-24)17-4-3-5-18(26)11-17/h3-14,31H,1-2H3,(H,28,29,30) |
| InChIKey | TYIMKBGQIBFBTJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|