C20H18FN7O4 — CID 174489146
[3-[[5-fluoro-4-(2H-pyrido[3,2-b][1,4]oxazin-6-ylamino)pyrimidin-2-yl]amino]phenoxy]methyl N-methylcarbamate (PubChem CID 174489146) has the molecular formula C20H18FN7O4 and a molecular weight of 439.41 g/mol. Its IUPAC name is [3-[[5-fluoro-4-(2H-pyrido[3,2-b][1,4]oxazin-6-ylamino)pyrimidin-2-yl]amino]phenoxy]methyl N-methylcarbamate.
| Compound Name | [3-[[5-fluoro-4-(2H-pyrido[3,2-b][1,4]oxazin-6-ylamino)pyrimidin-2-yl]amino]phenoxy]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 174489146 |
| Molecular Formula | C20H18FN7O4 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | [3-[[5-fluoro-4-(2H-pyrido[3,2-b][1,4]oxazin-6-ylamino)pyrimidin-2-yl]amino]phenoxy]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCOc1cccc(Nc2ncc(F)c(Nc3ccc4c(n3)N=CCO4)n2)c1 |
| InChI | InChI=1S/C20H18FN7O4/c1-22-20(29)32-11-31-13-4-2-3-12(9-13)25-19-24-10-14(21)17(28-19)26-16-6-5-15-18(27-16)23-7-8-30-15/h2-7,9-10H,8,11H2,1H3,(H,22,29)(H2,24,25,26,27,28) |
| InChIKey | CBIGHNIPGCRBHW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|