C18H17N5O3 — CID 112967408
methyl 2-[[3-(4-methoxyanilino)-1,2,4-triazin-5-yl]amino]benzoate (PubChem CID 112967408) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is methyl 2-[[3-(4-methoxyanilino)-1,2,4-triazin-5-yl]amino]benzoate.
| Compound Name | methyl 2-[[3-(4-methoxyanilino)-1,2,4-triazin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 112967408 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | methyl 2-[[3-(4-methoxyanilino)-1,2,4-triazin-5-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1cnnc(Nc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C18H17N5O3/c1-25-13-9-7-12(8-10-13)20-18-22-16(11-19-23-18)21-15-6-4-3-5-14(15)17(24)26-2/h3-11H,1-2H3,(H2,20,21,22,23) |
| InChIKey | HYSSHTSFEZODGK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |