C19H19N5O2 — CID 112963430
methyl 2-[[3-(3,4-dimethylanilino)-1,2,4-triazin-5-yl]amino]benzoate (PubChem CID 112963430) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is methyl 2-[[3-(3,4-dimethylanilino)-1,2,4-triazin-5-yl]amino]benzoate.
| Compound Name | methyl 2-[[3-(3,4-dimethylanilino)-1,2,4-triazin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 112963430 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | methyl 2-[[3-(3,4-dimethylanilino)-1,2,4-triazin-5-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1cnnc(Nc2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C19H19N5O2/c1-12-8-9-14(10-13(12)2)21-19-23-17(11-20-24-19)22-16-7-5-4-6-15(16)18(25)26-3/h4-11H,1-3H3,(H2,21,22,23,24) |
| InChIKey | INZXXGDLGFCEDG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |