C25H34N8O — CID 22134731
1-tert-butyl-3-[2-[4-(3,5-dimethylpiperazin-1-yl)anilino]-6-methylpyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 22134731) has the molecular formula C25H34N8O and a molecular weight of 462.60 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-[4-(3,5-dimethylpiperazin-1-yl)anilino]-6-methylpyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-tert-butyl-3-[2-[4-(3,5-dimethylpiperazin-1-yl)anilino]-6-methylpyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 22134731 |
| Molecular Formula | C25H34N8O |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 1-tert-butyl-3-[2-[4-(3,5-dimethylpiperazin-1-yl)anilino]-6-methylpyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | Cc1cc2cnc(Nc3ccc(N4CC(C)NC(C)C4)cc3)nc2nc1NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C25H34N8O/c1-15-11-18-12-26-23(30-22(18)29-21(15)31-24(34)32-25(4,5)6)28-19-7-9-20(10-8-19)33-13-16(2)27-17(3)14-33/h7-12,16-17,27H,13-14H2,1-6H3,(H3,26,28,29,30,31,32,34) |
| InChIKey | IWQRQXJFCBIGMI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|