C27H34N4O2 — CID 22124737
1-(2-bicyclo[2.2.1]heptanyl)-7-[4-[3-(hydroxymethyl)piperidin-1-yl]anilino]-3,4-dihydro-1,6-naphthyridin-2-one (PubChem CID 22124737) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-7-[4-[3-(hydroxymethyl)piperidin-1-yl]anilino]-3,4-dihydro-1,6-naphthyridin-2-one.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-7-[4-[3-(hydroxymethyl)piperidin-1-yl]anilino]-3,4-dihydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 22124737 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-7-[4-[3-(hydroxymethyl)piperidin-1-yl]anilino]-3,4-dihydro-1,6-naphthyridin-2-one |
| SMILES | O=C1CCc2cnc(Nc3ccc(N4CCCC(CO)C4)cc3)cc2N1C1CC2CCC1C2 |
| InChI | InChI=1S/C27H34N4O2/c32-17-19-2-1-11-30(16-19)23-8-6-22(7-9-23)29-26-14-25-21(15-28-26)5-10-27(33)31(25)24-13-18-3-4-20(24)12-18/h6-9,14-15,18-20,24,32H,1-5,10-13,16-17H2,(H,28,29) |
| InChIKey | PDIRQXMXCNXEJM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|