C20H30N4O2 — CID 113182232
1-butan-2-yl-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 113182232) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-butan-2-yl-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-butan-2-yl-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113182232 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 1-butan-2-yl-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCC(C)N1CC(C(=O)Nc2ccc(N3CCN(C)CC3)cc2)CC1=O |
| InChI | InChI=1S/C20H30N4O2/c1-4-15(2)24-14-16(13-19(24)25)20(26)21-17-5-7-18(8-6-17)23-11-9-22(3)10-12-23/h5-8,15-16H,4,9-14H2,1-3H3,(H,21,26) |
| InChIKey | QXUFNZVHNQRSHT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|