C30H34N4O2 — CID 41184848
(3S)-N-[4-(4-benzylpiperazin-1-yl)phenyl]-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxamide (PubChem CID 41184848) has the molecular formula C30H34N4O2 and a molecular weight of 482.63 g/mol. Its IUPAC name is (3S)-N-[4-(4-benzylpiperazin-1-yl)phenyl]-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[4-(4-benzylpiperazin-1-yl)phenyl]-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 41184848 |
| Molecular Formula | C30H34N4O2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | (3S)-N-[4-(4-benzylpiperazin-1-yl)phenyl]-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxamide |
| SMILES | C[C@H](c1ccccc1)N1C[C@@H](C(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)CC1=O |
| InChI | InChI=1S/C30H34N4O2/c1-23(25-10-6-3-7-11-25)34-22-26(20-29(34)35)30(36)31-27-12-14-28(15-13-27)33-18-16-32(17-19-33)21-24-8-4-2-5-9-24/h2-15,23,26H,16-22H2,1H3,(H,31,36)/t23-,26+/m1/s1 |
| InChIKey | JTIOCRCOJCVATL-BVAGGSTKSA-N |
| XLogP | 4.56 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|