About 1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea
1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea (PubChem CID 51944481) has the molecular formula C15H13BrF2N2O
and a molecular weight of 355.18 g/mol. Its IUPAC name is 1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea.
Molecular Properties
| Compound Name | 1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea |
| PubChem CID | 51944481 |
| Molecular Formula | C15H13BrF2N2O |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea |
| SMILES | C[C@@H](NC(=O)Nc1c(F)cccc1F)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H13BrF2N2O/c1-9(10-4-2-5-11(16)8-10)19-15(21)20-14-12(17)6-3-7-13(14)18/h2-9H,1H3,(H2,19,20,21)/t9-/m1/s1 |
| InChIKey | OUHHTFZTWPNKQI-SECBINFHSA-N |
| XLogP | 4.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea?
The IUPAC name of 1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea (CID 51944481) is 1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea.
What is the SMILES notation for 1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea?
The canonical SMILES for 1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea is C[C@@H](NC(=O)Nc1c(F)cccc1F)c1cccc(Br)c1.
What is the InChIKey of 1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea?
The InChIKey is OUHHTFZTWPNKQI-SECBINFHSA-N. The full InChI is InChI=1S/C15H13BrF2N2O/c1-9(10-4-2-5-11(16)8-10)19-15(21)20-14-12(17)6-3-7-13(14)18/h2-9H,1H3,(H2,19,20,21)/t9-/m1/s1.
What are the key properties of 1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea?
1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea has a molecular weight of 355.18 g/mol, XLogP of 4.61, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-1-(3-bromophenyl)ethyl]-3-(2,6-difluorophenyl)urea is sourced from PubChem (CID 51944481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).