C20H24N4O2S — CID 60611908
1-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea (PubChem CID 60611908) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 1-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea.
| Compound Name | 1-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 60611908 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea |
| SMILES | O=C(NCC(=O)N1CCCC1)Nc1ccc(N2CCc3sccc3C2)cc1 |
| InChI | InChI=1S/C20H24N4O2S/c25-19(23-9-1-2-10-23)13-21-20(26)22-16-3-5-17(6-4-16)24-11-7-18-15(14-24)8-12-27-18/h3-6,8,12H,1-2,7,9-11,13-14H2,(H2,21,22,26) |
| InChIKey | RRPNDZLNHQHICQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|