C17H18N4O3S — CID 86996837
N-(2-oxo-2-pyrrolidin-1-ylethyl)-N'-[4-(1,3-thiazol-2-yl)phenyl]oxamide (PubChem CID 86996837) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-(2-oxo-2-pyrrolidin-1-ylethyl)-N'-[4-(1,3-thiazol-2-yl)phenyl]oxamide.
| Compound Name | N-(2-oxo-2-pyrrolidin-1-ylethyl)-N'-[4-(1,3-thiazol-2-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 86996837 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-(2-oxo-2-pyrrolidin-1-ylethyl)-N'-[4-(1,3-thiazol-2-yl)phenyl]oxamide |
| SMILES | O=C(NCC(=O)N1CCCC1)C(=O)Nc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C17H18N4O3S/c22-14(21-8-1-2-9-21)11-19-15(23)16(24)20-13-5-3-12(4-6-13)17-18-7-10-25-17/h3-7,10H,1-2,8-9,11H2,(H,19,23)(H,20,24) |
| InChIKey | YPOUIHFPFNCJTL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|