C14H15N3OS — CID 81179825
1-amino-N-[4-(1,3-thiazol-2-yl)phenyl]cyclobutane-1-carboxamide (PubChem CID 81179825) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 1-amino-N-[4-(1,3-thiazol-2-yl)phenyl]cyclobutane-1-carboxamide.
| Compound Name | 1-amino-N-[4-(1,3-thiazol-2-yl)phenyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 81179825 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 1-amino-N-[4-(1,3-thiazol-2-yl)phenyl]cyclobutane-1-carboxamide |
| SMILES | NC1(C(=O)Nc2ccc(-c3nccs3)cc2)CCC1 |
| InChI | InChI=1S/C14H15N3OS/c15-14(6-1-7-14)13(18)17-11-4-2-10(3-5-11)12-16-8-9-19-12/h2-5,8-9H,1,6-7,15H2,(H,17,18) |
| InChIKey | UBTJIMAQDIFZJL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |