C16H19N3OS — CID 63044488
3-amino-N-[4-(1,3-thiazol-2-yl)phenyl]cyclohexane-1-carboxamide (PubChem CID 63044488) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 3-amino-N-[4-(1,3-thiazol-2-yl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[4-(1,3-thiazol-2-yl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 63044488 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-amino-N-[4-(1,3-thiazol-2-yl)phenyl]cyclohexane-1-carboxamide |
| SMILES | NC1CCCC(C(=O)Nc2ccc(-c3nccs3)cc2)C1 |
| InChI | InChI=1S/C16H19N3OS/c17-13-3-1-2-12(10-13)15(20)19-14-6-4-11(5-7-14)16-18-8-9-21-16/h4-9,12-13H,1-3,10,17H2,(H,19,20) |
| InChIKey | NNTPEIQQQYOIEZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |