C18H22ClN3O2S — CID 119759063
N-[4-[(3-aminocyclohexanecarbonyl)amino]phenyl]thiophene-2-carboxamide;hydrochloride (PubChem CID 119759063) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is N-[4-[(3-aminocyclohexanecarbonyl)amino]phenyl]thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[4-[(3-aminocyclohexanecarbonyl)amino]phenyl]thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119759063 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-[4-[(3-aminocyclohexanecarbonyl)amino]phenyl]thiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCCC(C(=O)Nc2ccc(NC(=O)c3cccs3)cc2)C1 |
| InChI | InChI=1S/C18H21N3O2S.ClH/c19-13-4-1-3-12(11-13)17(22)20-14-6-8-15(9-7-14)21-18(23)16-5-2-10-24-16;/h2,5-10,12-13H,1,3-4,11,19H2,(H,20,22)(H,21,23);1H |
| InChIKey | IEQBQAMERODREF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |