C22H22N4O2S — CID 112824892
4-benzoyl-N-[4-(1,3-thiazol-2-yl)phenyl]-1,4-diazepane-1-carboxamide (PubChem CID 112824892) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 4-benzoyl-N-[4-(1,3-thiazol-2-yl)phenyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-benzoyl-N-[4-(1,3-thiazol-2-yl)phenyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 112824892 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 4-benzoyl-N-[4-(1,3-thiazol-2-yl)phenyl]-1,4-diazepane-1-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nccs2)cc1)N1CCCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H22N4O2S/c27-21(18-5-2-1-3-6-18)25-12-4-13-26(15-14-25)22(28)24-19-9-7-17(8-10-19)20-23-11-16-29-20/h1-3,5-11,16H,4,12-15H2,(H,24,28) |
| InChIKey | HAZRPJVYNNBBTH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |