C21H23N3OS2 — CID 86875039
1-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-[1-(5-methylthiophen-2-yl)ethyl]urea (PubChem CID 86875039) has the molecular formula C21H23N3OS2 and a molecular weight of 397.57 g/mol. Its IUPAC name is 1-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-[1-(5-methylthiophen-2-yl)ethyl]urea.
| Compound Name | 1-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-[1-(5-methylthiophen-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 86875039 |
| Molecular Formula | C21H23N3OS2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 1-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-[1-(5-methylthiophen-2-yl)ethyl]urea |
| SMILES | Cc1ccc(C(C)NC(=O)Nc2ccc(N3CCc4sccc4C3)cc2)s1 |
| InChI | InChI=1S/C21H23N3OS2/c1-14-3-8-19(27-14)15(2)22-21(25)23-17-4-6-18(7-5-17)24-11-9-20-16(13-24)10-12-26-20/h3-8,10,12,15H,9,11,13H2,1-2H3,(H2,22,23,25) |
| InChIKey | IJGOEZRGKLCYKU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|