C22H22ClN5O2S — CID 167847919
5-chloro-N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-2-morpholin-4-ylpyrimidine-4-carboxamide (PubChem CID 167847919) has the molecular formula C22H22ClN5O2S and a molecular weight of 455.97 g/mol. Its IUPAC name is 5-chloro-N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-2-morpholin-4-ylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-2-morpholin-4-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 167847919 |
| Molecular Formula | C22H22ClN5O2S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 5-chloro-N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-2-morpholin-4-ylpyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCc3sccc3C2)cc1)c1nc(N2CCOCC2)ncc1Cl |
| InChI | InChI=1S/C22H22ClN5O2S/c23-18-13-24-22(27-8-10-30-11-9-27)26-20(18)21(29)25-16-1-3-17(4-2-16)28-7-5-19-15(14-28)6-12-31-19/h1-4,6,12-13H,5,7-11,14H2,(H,25,29) |
| InChIKey | FETFLOYGGATQPS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|