C20H16F2N2OS — CID 51129821
N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3,4-difluorobenzamide (PubChem CID 51129821) has the molecular formula C20H16F2N2OS and a molecular weight of 370.42 g/mol. Its IUPAC name is N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3,4-difluorobenzamide.
| Compound Name | N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 51129821 |
| Molecular Formula | C20H16F2N2OS |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3,4-difluorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCc3sccc3C2)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H16F2N2OS/c21-17-6-1-13(11-18(17)22)20(25)23-15-2-4-16(5-3-15)24-9-7-19-14(12-24)8-10-26-19/h1-6,8,10-11H,7,9,12H2,(H,23,25) |
| InChIKey | NOVXLMFCOIMEMG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|