C23H19FN2O3 — CID 155143292
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]-3-fluoro-5-formyl-4-hydroxybenzamide (PubChem CID 155143292) has the molecular formula C23H19FN2O3 and a molecular weight of 390.41 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]-3-fluoro-5-formyl-4-hydroxybenzamide.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]-3-fluoro-5-formyl-4-hydroxybenzamide |
|---|---|
| PubChem CID | 155143292 |
| Molecular Formula | C23H19FN2O3 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]-3-fluoro-5-formyl-4-hydroxybenzamide |
| SMILES | O=Cc1cc(C(=O)Nc2ccc(N3CCc4ccccc4C3)cc2)cc(F)c1O |
| InChI | InChI=1S/C23H19FN2O3/c24-21-12-17(11-18(14-27)22(21)28)23(29)25-19-5-7-20(8-6-19)26-10-9-15-3-1-2-4-16(15)13-26/h1-8,11-12,14,28H,9-10,13H2,(H,25,29) |
| InChIKey | HKDMPQPJNNDUEE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|