C21H19FN2O3 — CID 155155324
3-fluoro-5-formyl-4-hydroxy-N-[4-[(3-methyl-2-methylidenecyclopentylidene)amino]phenyl]benzamide (PubChem CID 155155324) has the molecular formula C21H19FN2O3 and a molecular weight of 366.39 g/mol. Its IUPAC name is 3-fluoro-5-formyl-4-hydroxy-N-[4-[(3-methyl-2-methylidenecyclopentylidene)amino]phenyl]benzamide.
| Compound Name | 3-fluoro-5-formyl-4-hydroxy-N-[4-[(3-methyl-2-methylidenecyclopentylidene)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 155155324 |
| Molecular Formula | C21H19FN2O3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-fluoro-5-formyl-4-hydroxy-N-[4-[(3-methyl-2-methylidenecyclopentylidene)amino]phenyl]benzamide |
| SMILES | C=C1/C(=N\c2ccc(NC(=O)c3cc(F)c(O)c(C=O)c3)cc2)CCC1C |
| InChI | InChI=1S/C21H19FN2O3/c1-12-3-8-19(13(12)2)23-16-4-6-17(7-5-16)24-21(27)14-9-15(11-25)20(26)18(22)10-14/h4-7,9-12,26H,2-3,8H2,1H3,(H,24,27)/b23-19- |
| InChIKey | YFTPHCXDGNALSL-NMWGTECJSA-N |
| XLogP | 4.65 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|