C20H30N2O5 — CID 108504049
N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide (PubChem CID 108504049) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108504049 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide |
| SMILES | CCOc1ccc(CCNC(=O)C(=O)N2CC(C)OC(C)C2)cc1OCC |
| InChI | InChI=1S/C20H30N2O5/c1-5-25-17-8-7-16(11-18(17)26-6-2)9-10-21-19(23)20(24)22-12-14(3)27-15(4)13-22/h7-8,11,14-15H,5-6,9-10,12-13H2,1-4H3,(H,21,23) |
| InChIKey | GUHJSUXSXSQNDM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|