C16H21N5O4 — CID 108519171
N-[2-(3,4-diethoxyphenyl)ethyl]-N'-(1,2,4-triazol-4-yl)oxamide (PubChem CID 108519171) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-N'-(1,2,4-triazol-4-yl)oxamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-N'-(1,2,4-triazol-4-yl)oxamide |
|---|---|
| PubChem CID | 108519171 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-N'-(1,2,4-triazol-4-yl)oxamide |
| SMILES | CCOc1ccc(CCNC(=O)C(=O)Nn2cnnc2)cc1OCC |
| InChI | InChI=1S/C16H21N5O4/c1-3-24-13-6-5-12(9-14(13)25-4-2)7-8-17-15(22)16(23)20-21-10-18-19-11-21/h5-6,9-11H,3-4,7-8H2,1-2H3,(H,17,22)(H,20,23) |
| InChIKey | HHWOTNPQFGQHPA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|