C18H25N3O3 — CID 134060511
N-[2-(3,4-diethoxyphenyl)ethyl]-2-pyrazol-1-ylpropanamide (PubChem CID 134060511) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2-pyrazol-1-ylpropanamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 134060511 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-pyrazol-1-ylpropanamide |
| SMILES | CCOc1ccc(CCNC(=O)C(C)n2cccn2)cc1OCC |
| InChI | InChI=1S/C18H25N3O3/c1-4-23-16-8-7-15(13-17(16)24-5-2)9-11-19-18(22)14(3)21-12-6-10-20-21/h6-8,10,12-14H,4-5,9,11H2,1-3H3,(H,19,22) |
| InChIKey | WXUSOANPIUCFNP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |