C17H26N2O5 — CID 108526714
N-[2-(3,4-diethoxyphenyl)ethyl]-N'-(2-hydroxyethyl)-N'-methyloxamide (PubChem CID 108526714) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-N'-(2-hydroxyethyl)-N'-methyloxamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-N'-(2-hydroxyethyl)-N'-methyloxamide |
|---|---|
| PubChem CID | 108526714 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-N'-(2-hydroxyethyl)-N'-methyloxamide |
| SMILES | CCOc1ccc(CCNC(=O)C(=O)N(C)CCO)cc1OCC |
| InChI | InChI=1S/C17H26N2O5/c1-4-23-14-7-6-13(12-15(14)24-5-2)8-9-18-16(21)17(22)19(3)10-11-20/h6-7,12,20H,4-5,8-11H2,1-3H3,(H,18,21) |
| InChIKey | GXHKAASXMRMTRQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|